Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Ethyl (2,4-Dichloro-6-Formylphenoxy)Acetate |
|---|---|
| Synonyms | ethyl 2-(2,4-dichloro-6-formylphenoxy)acetate; ETHYL2-(2,4-DICHLORO-6-FORMYLPHENOXY)ACETATE; ZINC00162708 |
| Molecular Structure |  |
| Molecular Formula | C11H10Cl2O4 |
| Molecular Weight | 277.10 |
| CAS Registry Number | 16861-40-8 |
| SMILES | Clc1cc(Cl)cc(c1OCC(=O)OCC)C=O |
| InChI | 1S/C11H10Cl2O4/c1-2-16-10(15)6-17-11-7(5-14)3-8(12)4-9(11)13/h3-5H,2,6H2,1H3 |
| InChIKey | QPUVQSXODORTAY-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.125°C at 760 mmHg (Cal.) |
| Flash point | 152.648°C (Cal.) |
| Refractive index | 1.558 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2,4-Dichloro-6-Formylphenoxy)Acetate |