Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| IRIS Biotech GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (9231) 961-973 | |||
|
info@iris-biotech.de | |||
| Chemical manufacturer since 1788 | ||||
| Name | Roridin E |
|---|---|
| Synonyms | Roridine E; Verrucarin A, 2',3'-Didehydro-7'-Deoxo-2'-Deoxy-7'-((1R)-1-Hydroxyethyl)-, (2'E,7'R)- |
| Molecular Structure |  |
| Molecular Formula | C29H38O8 |
| Molecular Weight | 514.61 |
| CAS Registry Number | 16891-85-3 |
| SMILES | [C@@]24([C@@]1(OC1)C5O[C@H]3[C@@]2(CCC(=C3)C)COC(=O)\C=C(CCO[C@H](/C=C\C=C/C(O[C@@H]4C5)=O)[C@H](O)C)\C)C |
| InChI | 1S/C29H38O8/c1-18-9-11-28-16-34-26(32)14-19(2)10-12-33-21(20(3)30)7-5-6-8-25(31)37-22-15-24(36-23(28)13-18)29(17-35-29)27(22,28)4/h5-8,13-14,20-24,30H,9-12,15-17H2,1-4H3/b7-5-,8-6-,19-14-/t20-,21-,22-,23-,24?,27-,28-,29+/m1/s1 |
| InChIKey | KEEQQEKLEZRLDS-ISRVQPDQSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 740.342°C at 760 mmHg (Cal.) |
| Flash point | 243.457°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Roridin E |