Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-Fluoropyrene |
|---|---|
| Synonyms | Pyrene, 1-Fluoro- |
| Molecular Structure |  |
| Molecular Formula | C16H9F |
| Molecular Weight | 220.25 |
| CAS Registry Number | 1691-65-2 |
| SMILES | C2=CC1=CC=CC4=C1C3=C2C(=CC=C3C=C4)F |
| InChI | 1S/C16H9F/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H |
| InChIKey | IJGKLOPKLNXDDS-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.868°C at 760 mmHg (Cal.) |
| Flash point | 149.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Fluoropyrene |