| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 2-(4-Sulfophenyl)Alanine |
|---|---|
| Synonyms | (RS)-a-Methyl-4-sulfonophenylglycine; (RS)-MSPG; [169209-64-7] |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.25 |
| CAS Registry Number | 169209-64-7 |
| SMILES | CC(C1=CC=C(C=C1)S(=O)(=O)O)(C(=O)O)N |
| InChI | 1S/C9H11NO5S/c1-9(10,8(11)12)6-2-4-7(5-3-6)16(13,14)15/h2-5H,10H2,1H3,(H,11,12)(H,13,14,15) |
| InChIKey | MVDSFPIEJILRME-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Refractive index | 1.618 (Cal.) |
| solubility | Soluble to 100 mM in 1eq. NaOH |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Sulfophenyl)Alanine |