|
CAS#: 1693-63-6 Product: 21-Hydroxypregnenolone 3,21-Diacetate No suppilers available for the product. |
| Name | 21-Hydroxypregnenolone 3,21-Diacetate |
|---|---|
| Synonyms | [17-(2-Acetoxyacetyl)-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl] Acetate; Acetic Acid [17-(2-Acetoxy-1-Oxoethyl)-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl] Ester; Acetic Acid [17-(2-Acetoxyacetyl)-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 |
| CAS Registry Number | 1693-63-6 |
| EINECS | 216-896-3 |
| SMILES | C(C(C4C3(C(C1C(C2(C(=CC1)CC(OC(C)=O)CC2)C)CC3)CC4)C)=O)OC(C)=O |
| InChI | 1S/C25H36O5/c1-15(26)29-14-23(28)22-8-7-20-19-6-5-17-13-18(30-16(2)27)9-11-24(17,3)21(19)10-12-25(20,22)4/h5,18-22H,6-14H2,1-4H3 |
| InChIKey | UVOTXHBDYFWIBF-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.993°C at 760 mmHg (Cal.) |
| Flash point | 216.696°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 21-Hydroxypregnenolone 3,21-Diacetate |