|
CAS#: 16931-47-8 Product: 2-{[Methyl(Phenyl)Amino]Carbonyl}Benzoic Acid No suppilers available for the product. |
| Name | 2-{[Methyl(Phenyl)Amino]Carbonyl}Benzoic Acid |
|---|---|
| Synonyms | 2-(Cyclohexyl-Methyl-Carbamoyl)Benzoate; 2-[(Cyclohexyl-Methylamino)-Oxomethyl]Benzoate; Zinc03042613 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18NO3 |
| Molecular Weight | 260.31 |
| CAS Registry Number | 16931-47-8 |
| SMILES | C1=CC=CC(=C1C(=O)N(C2CCCCC2)C)C([O-])=O |
| InChI | 1S/C15H19NO3/c1-16(11-7-3-2-4-8-11)14(17)12-9-5-6-10-13(12)15(18)19/h5-6,9-11H,2-4,7-8H2,1H3,(H,18,19)/p-1 |
| InChIKey | VWCGBSLMTUMNKU-UHFFFAOYSA-M |
| Boiling point | 460.993°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 232.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-{[Methyl(Phenyl)Amino]Carbonyl}Benzoic Acid |