|
CAS#: 1694-19-5 Product: 1-Methoxy-4-((E)-Styryl)-Benzene No suppilers available for the product. |
| Name | 1-Methoxy-4-((E)-Styryl)-Benzene |
|---|---|
| Synonyms | 1-Methoxy-4-(2-Phenylethenyl)Benzene; 1-Methoxy-4-(2-Phenylvinyl)Benzene; 1-Methoxy-4-[(E)-2-Phenylvinyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 |
| CAS Registry Number | 1694-19-5 |
| SMILES | C2=C(\C=C\C1=CC=CC=C1)C=CC(=C2)OC |
| InChI | 1S/C15H14O/c1-16-15-11-9-14(10-12-15)8-7-13-5-3-2-4-6-13/h2-12H,1H3/b8-7+ |
| InChIKey | XWYXLYCDZKRCAD-BQYQJAHWSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Melting point | 134-136°C (Expl.) |
| Boiling point | 341.471°C at 760 mmHg (Cal.) |
| Flash point | 135.368°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-4-((E)-Styryl)-Benzene |