| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | 2-(2-Ethoxyphenoxy)ethyl methanesulfonate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 |
| CAS Registry Number | 169506-15-4 |
| SMILES | CCOC1=CC=CC=C1OCCOS(=O)(=O)C |
| Solubility | 2247 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.0 g/cm3, Calc.* |
| Index of Refraction | 1.508, Calc.* |
| Melting point | 122.72 °C |
| Boiling Point | 413.0±0.0 °C (760 mmHg), Calc.*, 362.88 °C |
| Flash Point | 203.6±0.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Ethoxyphenoxy)ethyl methanesulfonate |