Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Cyanomethyl 5-Fluoro-2-(Methylamino)Nicotinate |
|---|---|
| Synonyms | cyanomethyl 5-fluoro-2-(methylamino)nicotinate |
| Molecular Structure |  |
| Molecular Formula | C9H8FN3O2 |
| Molecular Weight | 209.18 |
| CAS Registry Number | 169806-36-4 |
| SMILES | CNc1c(cc(cn1)F)C(=O)OCC#N |
| InChI | 1S/C9H8FN3O2/c1-12-8-7(4-6(10)5-13-8)9(14)15-3-2-11/h4-5H,3H2,1H3,(H,12,13) |
| InChIKey | WLQSZWYXVBRPIL-UHFFFAOYSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.54°C at 760 mmHg (Cal.) |
| Flash point | 177.292°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyanomethyl 5-Fluoro-2-(Methylamino)Nicotinate |