Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-2-Propanyl (3S,4E)-4-Hexen-3-Ylcarbamate |
|---|---|
| Synonyms | (S,E)-tert-butyl hex-4-en-3-ylcarbamate |
| Molecular Structure |  |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 |
| CAS Registry Number | 170080-37-2 |
| SMILES | CC[C@@H](/C=C/C)NC(=O)OC(C)(C)C |
| InChI | 1S/C11H21NO2/c1-6-8-9(7-2)12-10(13)14-11(3,4)5/h6,8-9H,7H2,1-5H3,(H,12,13)/b8-6+/t9-/m0/s1 |
| InChIKey | KUJYSYCIKDBIGR-ORZBULNSSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.2±19.0°C at 760 mmHg (Cal.) |
| Flash point | 118.4±21.5°C (Cal.) |
| Refractive index | 1.452 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl (3S,4E)-4-Hexen-3-Ylcarbamate |