Online Database of Chemicals from Around the World
|
CAS#: 17025-30-8 Product: 4-(4-Dimethylaminophenylazo)Quinoline No suppilers available for the product. |
| Name | 4-(4-Dimethylaminophenylazo)Quinoline |
|---|---|
| Synonyms | N,N-Dimethyl-4-(4-Quinolylazo)Aniline; Dimethyl-[4-(4-Quinolylazo)Phenyl]Amine; N,N-Dimethyl-4-Quinolin-4-Yldiazenyl-Aniline |
| Molecular Structure |  |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 |
| CAS Registry Number | 17025-30-8 |
| SMILES | C1=CC(=CC=C1N(C)C)N=NC2=C3C(=NC=C2)C=CC=C3 |
| InChI | 1S/C17H16N4/c1-21(2)14-9-7-13(8-10-14)19-20-17-11-12-18-16-6-4-3-5-15(16)17/h3-12H,1-2H3 |
| InChIKey | KBENBTOTLFPADB-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.275°C at 760 mmHg (Cal.) |
| Flash point | 238.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Dimethylaminophenylazo)Quinoline |