Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Chem Service, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (610) 692-3026 | |||
|
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Name | Manganese(2+) Bis(2-Hydroxybenzoate) |
|---|---|
| Synonyms | manganese disalicylate; MANGANESE SALICYLATE |
| Molecular Structure |  |
| Molecular Formula | C14H10MnO6 |
| Molecular Weight | 329.16 |
| CAS Registry Number | 17032-49-4 |
| SMILES | [Mn+2].O=C([O-])c1ccccc1O.[O-]C(=O)c1ccccc1O |
| InChI | 1S/2C7H6O3.Mn/c2*8-6-4-2-1-3-5(6)7(9)10;/h2*1-4,8H,(H,9,10);/q;;+2/p-2 |
| InChIKey | OZIKUNPJXSWSMD-UHFFFAOYSA-L |
| Boiling point | 336.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.5°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganese(2+) Bis(2-Hydroxybenzoate) |