Online Database of Chemicals from Around the World
| Name | 1-Cyclohexenyl-Phenyl-Methanone |
|---|---|
| Synonyms | 1-Cyclohexenyl-Phenyl-Methanone; Methanone, 1-Cyclohexen-1-Ylphenyl-; Nsc67398 |
| Molecular Structure |  |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 |
| CAS Registry Number | 17040-65-2 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CCCCC2 |
| InChI | 1S/C13H14O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-9H,2,5-6,10H2 |
| InChIKey | GFXUKSMUKHKIGP-UHFFFAOYSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.938°C at 760 mmHg (Cal.) |
| Flash point | 126.609°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Cyclohexenyl-Phenyl-Methanone |
