Online Database of Chemicals from Around the World
|
CAS#: 170653-86-8 Product: 6-Methylaceanthrylene No suppilers available for the product. |
| Name | 6-Methylaceanthrylene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 |
| CAS Registry Number | 170653-86-8 |
| SMILES | C4=C2C1=C(C=CC1=C3C(=C2C)C=CC=C3)C=C4 |
| InChI | 1S/C17H12/c1-11-13-6-2-3-7-15(13)16-10-9-12-5-4-8-14(11)17(12)16/h2-10H,1H3 |
| InChIKey | XIHBIKWZKWLRQI-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.329°C at 760 mmHg (Cal.) |
| Flash point | 197.334°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methylaceanthrylene |