Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Ethenyl-Pyrene |
|---|---|
| Synonyms | 1-Vinylpyrene; 3-Vinylpyrene; Ccris 4257 |
| Molecular Structure |  |
| Molecular Formula | C18H12 |
| Molecular Weight | 228.29 |
| CAS Registry Number | 17088-21-0 |
| SMILES | C1=C4C3=C2C(=C1)C=CC=C2C=CC3=CC=C4C=C |
| InChI | 1S/C18H12/c1-2-12-6-7-15-9-8-13-4-3-5-14-10-11-16(12)18(15)17(13)14/h2-11H,1H2 |
| InChIKey | WPMHMYHJGDAHKX-UHFFFAOYSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.757°C at 760 mmHg (Cal.) |
| Flash point | 193.027°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethenyl-Pyrene |