| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Upadacitinib Impurity 8 |
|---|---|
| Synonyms | 8-((3R,4S)-4-ethylpyrrolidin-3-yl)-3H-imidazo[1,2-a]pyrrolo[2,3-e]pyrazine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 |
| CAS Registry Number | 1708997-43-6 |
| EC Number | 823-377-0 |
| SMILES | CC[C@@H]1CNC[C@@H]1C2=CN=C3N2C4=C(NC=C4)N=C3 |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.786, Calc.* |
| Boiling Point | 443.9±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 222.3±28.7 °C, Calc.* |
| Market Analysis Reports |
| List of Reports Available for Upadacitinib Impurity 8 |