Online Database of Chemicals from Around the World
|
CAS#: 17112-43-5 Product: Dihydrogen Hexachlorotellurate(2-) No suppilers available for the product. |
| Name | Dihydrogen Hexachlorotellurate(2-) |
|---|---|
| Synonyms | dihydrogen hexachlorotellurate(2-) |
| Molecular Structure |  |
| Molecular Formula | Cl6Te |
| CAS Registry Number | 17112-43-5 |
| EINECS | 241-180-2 |
| SMILES | [H+].[H+].Cl[Te-2](Cl)(Cl)(Cl)(Cl)Cl |
| InChI | 1S/Cl6Te/c1-7(2,3,4,5)6/q-2/p+2 |
| InChIKey | VKIQSBBDOBAHRQ-UHFFFAOYSA-P |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dihydrogen Hexachlorotellurate(2-) |