Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl (3R)-3-Ethyl-L-Prolinate |
|---|---|
| Synonyms | (2S,3R)-methyl 3-ethylpyrrolidine-2-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 171232-79-4 |
| SMILES | CC[C@@H]1CCN[C@@H]1C(=O)OC |
| InChI | 1S/C8H15NO2/c1-3-6-4-5-9-7(6)8(10)11-2/h6-7,9H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | AVIDDEJFXYOMDO-RQJHMYQMSA-N |
| Density | 0.983g/cm3 (Cal.) |
|---|---|
| Boiling point | 203.98°C at 760 mmHg (Cal.) |
| Flash point | 77.165°C (Cal.) |
| Refractive index | 1.439 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (3R)-3-Ethyl-L-Prolinate |