Online Database of Chemicals from Around the World
|
CAS#: 17151-27-8 Product: Benzyldimethylethoxysilane No suppilers available for the product. |
| Name | Benzyldimethylethoxysilane |
|---|---|
| Synonyms | Benzyl-Ethoxy-Dimethyl-Silane; Benzyldimethylethoxysilane; Benzylethoxydimethylsilane |
| Molecular Structure |  |
| Molecular Formula | C11H18OSi |
| Molecular Weight | 194.35 |
| CAS Registry Number | 17151-27-8 |
| EINECS | 241-210-4 |
| SMILES | C1=CC=CC=C1C[Si](OCC)(C)C |
| InChI | 1S/C11H18OSi/c1-4-12-13(2,3)10-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3 |
| InChIKey | RFXODRCAZTVEOH-UHFFFAOYSA-N |
| Density | 0.909g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.739°C at 760 mmHg (Cal.) |
| Flash point | 79.596°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzyldimethylethoxysilane |