Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(Chloromethyl)-2-Fluoro-3,4-Dimethoxy-Benzene |
|---|---|
| Synonyms | 1-(Chloromethyl)-2-Fluoro-3,4-Dimethoxy-Benzene; Nsc40842 |
| Molecular Structure |  |
| Molecular Formula | C9H10ClFO2 |
| Molecular Weight | 204.63 |
| CAS Registry Number | 1716-43-4 |
| SMILES | C1=CC(=C(C(=C1CCl)F)OC)OC |
| InChI | 1S/C9H10ClFO2/c1-12-7-4-3-6(5-10)8(11)9(7)13-2/h3-4H,5H2,1-2H3 |
| InChIKey | RASIHJHGNLXRPH-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.991°C at 760 mmHg (Cal.) |
| Flash point | 107.41°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(Chloromethyl)-2-Fluoro-3,4-Dimethoxy-Benzene |