Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl Dinitrocarbamate |
|---|---|
| Synonyms | ethyl dinitrocarbamate |
| Molecular Structure |  |
| Molecular Formula | C3H5N3O6 |
| Molecular Weight | 179.09 |
| CAS Registry Number | 171608-05-2 |
| SMILES | O=N(=O)N(C(=O)OCC)N(=O)=O |
| InChI | 1S/C3H5N3O6/c1-2-12-3(7)4(5(8)9)6(10)11/h2H2,1H3 |
| InChIKey | LAOHKKCMIUJCJW-UHFFFAOYSA-N |
| Density | 1.566g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.272°C at 760 mmHg (Cal.) |
| Flash point | 132.981°C (Cal.) |
| Refractive index | 1.497 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl Dinitrocarbamate |