Online Database of Chemicals from Around the World
| Name | Propadienylphosphonic Dichloride |
|---|---|
| Synonyms | 1-Dichlorophosphorylallene; Phosphonic Dichloride, 1,2-Propadienyl- |
| Molecular Structure |  |
| Molecular Formula | C3H3Cl2OP |
| Molecular Weight | 156.94 |
| CAS Registry Number | 17166-36-8 |
| SMILES | O=[P](Cl)(Cl)[CH]=[C]=[CH2] |
| InChI | 1S/C3H3Cl2OP/c1-2-3-7(4,5)6/h3H,1H2 |
| InChIKey | VRXGHOPIMKAYJL-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 203.584°C at 760 mmHg (Cal.) |
| Flash point | 76.925°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propadienylphosphonic Dichloride |
