Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,4-Diisopropyl-2-Methyl-2,5-Dihydro-1H-Imidazole |
|---|---|
| Synonyms | 2,4-diisopropyl-2-methyl-2,5-dihydro-1H-imidazole |
| Molecular Structure |  |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 |
| CAS Registry Number | 171974-61-1 |
| SMILES | N\1=C(/C(C)C)CNC/1(C)C(C)C |
| InChI | 1S/C10H20N2/c1-7(2)9-6-11-10(5,12-9)8(3)4/h7-8,11H,6H2,1-5H3 |
| InChIKey | ULIYGCOBTQRJFX-UHFFFAOYSA-N |
| Density | 0.959g/cm3 (Cal.) |
|---|---|
| Boiling point | 215.24°C at 760 mmHg (Cal.) |
| Flash point | 83.975°C (Cal.) |
| Refractive index | 1.502 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diisopropyl-2-Methyl-2,5-Dihydro-1H-Imidazole |