|
CAS#: 17265-13-3 Product: Disodium Azelate No suppilers available for the product. |
| Name | Disodium Azelate |
|---|---|
| Synonyms | Disodium Azelaate; Disodium Azelate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14Na2O4 |
| Molecular Weight | 232.19 |
| CAS Registry Number | 17265-13-3 |
| EINECS | 241-298-4 |
| SMILES | C(C([O-])=O)CCCCCCC([O-])=O.[Na+].[Na+] |
| InChI | 1S/C9H16O4.2Na/c10-8(11)6-4-2-1-3-5-7-9(12)13;;/h1-7H2,(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | QFYNUCAKHMSPCY-UHFFFAOYSA-L |
| Boiling point | 370.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium Azelate |