|
CAS#: 17276-03-8 Product: 1,3,6,8-Tetramethoxynaphthalene No suppilers available for the product. |
| Name | 1,3,6,8-Tetramethoxynaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,3,6,8-tetramethoxy-; Naphthalene,1,3,6,8-tetramethoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.27 |
| CAS Registry Number | 17276-03-8 |
| SMILES | O(c1cc2c(c(OC)c1)c(OC)cc(OC)c2)C |
| InChI | 1S/C14H16O4/c1-15-10-5-9-6-11(16-2)8-13(18-4)14(9)12(7-10)17-3/h5-8H,1-4H3 |
| InChIKey | KDLIYXYCQGGYNO-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.422°C at 760 mmHg (Cal.) |
| Flash point | 152.58°C (Cal.) |
| Refractive index | 1.558 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,6,8-Tetramethoxynaphthalene |