Online Database of Chemicals from Around the World
|
CAS#: 1729-61-9 Product: 4-(Fluoren-9-Ylidenemethyl)Benzenecarboximidamide No suppilers available for the product. |
| Name | 4-(Fluoren-9-Ylidenemethyl)Benzenecarboximidamide |
|---|---|
| Synonyms | 4-(Fluoren-9-Ylidenemethyl)Benzamidine; 4-(9-Fluorenylidenemethyl)Benzamidine; 4-(9-Fluorenylidenmethyl)Benzamidin |
| Molecular Structure |  |
| Molecular Formula | C21H16N2 |
| Molecular Weight | 296.37 |
| CAS Registry Number | 1729-61-9 |
| SMILES | C1=CC=CC2=C1C(C3=C2C=CC=C3)=CC4=CC=C(C=C4)C(N)=N |
| InChI | 1S/C21H16N2/c22-21(23)15-11-9-14(10-12-15)13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-13H,(H3,22,23) |
| InChIKey | WOVTUUKKGNHVFZ-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.097°C at 760 mmHg (Cal.) |
| Flash point | 238.107°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Fluoren-9-Ylidenemethyl)Benzenecarboximidamide |