| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Naphthalenes |
|---|---|
| Name | 3-Amino-1,4-dioxo-1,4-dihydronaphthalene-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 |
| CAS Registry Number | 173043-38-4 |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=N)C2=O)C(=O)O)O |
| Solubility | 1 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.685, Calc.* |
| Melting point | 306.10 °C |
| Boiling Point | 494.16 °C, 380.9±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 184.1±27.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Amino-1,4-dioxo-1,4-dihydronaphthalene-2-carboxylic acid |