|
CAS#: 1734-91-4 Product: 2-(2-Biphenylyloxy)-Triethylamine Hydrochloride No suppilers available for the product. |
| Name | 2-(2-Biphenylyloxy)-Triethylamine Hydrochloride |
|---|---|
| Synonyms | Diethyl-[2-(2-Phenylphenoxy)Ethyl]Amine Hydrochloride; 1262 F; 2-(2-Biphenylyloxy)Triethylamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24ClNO |
| Molecular Weight | 305.85 |
| CAS Registry Number | 1734-91-4 |
| SMILES | [H+].C1=C(OCCN(CC)CC)C(=CC=C1)C2=CC=CC=C2.[Cl-] |
| InChI | 1S/C18H23NO.ClH/c1-3-19(4-2)14-15-20-18-13-9-8-12-17(18)16-10-6-5-7-11-16;/h5-13H,3-4,14-15H2,1-2H3;1H |
| InChIKey | COMYJNPWDUUIDJ-UHFFFAOYSA-N |
| Boiling point | 367.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 108.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Biphenylyloxy)-Triethylamine Hydrochloride |