|
CAS#: 17343-02-1 Product: (2S)-2-{[N-(Ammonioacetyl)Glycyl]Amino}-4-(Methylsulfanyl)Butanoate No suppilers available for the product. |
| Name | (2S)-2-{[N-(Ammonioacetyl)Glycyl]Amino}-4-(Methylsulfanyl)Butanoate |
|---|---|
| Synonyms | H-GLY-GLY-MET-OH; ZINC02390902 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.31 |
| CAS Registry Number | 17343-02-1 |
| SMILES | O=C(N[C@H](C([O-])=O)CCSC)CNC(=O)C[NH3+] |
| InChI | 1S/C9H17N3O4S/c1-17-3-2-6(9(15)16)12-8(14)5-11-7(13)4-10/h6H,2-5,10H2,1H3,(H,11,13)(H,12,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | QPCVIQJVRGXUSA-LURJTMIESA-N |
| Density | 1.305g/cm3 (Cal.) |
|---|---|
| Boiling point | 655.638°C at 760 mmHg (Cal.) |
| Flash point | 350.318°C (Cal.) |
| Refractive index | 1.548 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-{[N-(Ammonioacetyl)Glycyl]Amino}-4-(Methylsulfanyl)Butanoate |