|
CAS#: 17374-49-1 Product: 4-Nitrophenyl 2-Hydroxy-5-Nitrobenzoate No suppilers available for the product. |
| Name | 4-Nitrophenyl 2-Hydroxy-5-Nitrobenzoate |
|---|---|
| Synonyms | 2-Hydroxy-5-nitrobenzoate de 4-nitrophényle; 4-Nitrophenyl 2-hydroxy-5-nitrobenzoate; 4-Nitrophenyl-2-hydroxy-5-nitrobenzoat |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8N2O7 |
| Molecular Weight | 304.21 |
| CAS Registry Number | 17374-49-1 |
| SMILES | c1cc(ccc1[N+](=O)[O-])OC(=O)c2cc(ccc2O)[N+](=O)[O-] |
| InChI | 1S/C13H8N2O7/c16-12-6-3-9(15(20)21)7-11(12)13(17)22-10-4-1-8(2-5-10)14(18)19/h1-7,16H |
| InChIKey | RKASYGMMWOLFLI-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.3±50.0°C at 760 mmHg (Cal.) |
| Flash point | 256.4±30.1°C (Cal.) |
| Refractive index | 1.67 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenyl 2-Hydroxy-5-Nitrobenzoate |