| BeLang Pharma Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.belangpharma.com | |||
![]() | +86 13885682355 | |||
![]() | info@belangpharma.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2019 | ||||
| chemBlink Standard supplier since 2019 | ||||
| Name | Ethyl (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-pyrrolidinecarboxylate |
|---|---|
| Synonyms | ethyl 4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.41 |
| CAS Registry Number | 173937-93-4 |
| SMILES | CCOC(=O)C1C(CNC1C2=CC=C(C=C2)OC)C3=CC4=C(C=C3)OCO4 |
| Solubility | 246.5 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.569, Calc.* |
| Melting point | 199.23 °C |
| Boiling Point | 471.39 °C, 498.6±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 255.4±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-pyrrolidinecarboxylate |