|
CAS#: 174008-48-1 Product: 2-Chloro-4-(Trifluoromethyl)Nicotinaldehyde No suppilers available for the product. |
| Name | 2-Chloro-4-(Trifluoromethyl)Nicotinaldehyde |
|---|---|
| Synonyms | 2-Chloro-4-(trifluoromethyl)pyridine-3-carbaldehyde; MFCD09907846 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H3ClF3NO |
| Molecular Weight | 209.55 |
| CAS Registry Number | 174008-48-1 |
| SMILES | c1cnc(c(c1C(F)(F)F)C=O)Cl |
| InChI | 1S/C7H3ClF3NO/c8-6-4(3-13)5(1-2-12-6)7(9,10)11/h1-3H |
| InChIKey | YXIMMXIGICNTOF-UHFFFAOYSA-N |
| Density | 1.499g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.025°C at 760 mmHg (Cal.) |
| Flash point | 107.431°C (Cal.) |
| Refractive index | 1.498 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-4-(Trifluoromethyl)Nicotinaldehyde |