Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-Nitropropiophenone |
|---|---|
| Synonyms | Nciopen2_001330; Nsc90987 |
| Molecular Structure |  |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 |
| CAS Registry Number | 17408-15-0 |
| SMILES | C1=CC=CC(=C1C(=O)CC)[N+]([O-])=O |
| InChI | 1S/C9H9NO3/c1-2-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
| InChIKey | IRECTDZFQAWHEC-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.429°C at 760 mmHg (Cal.) |
| Flash point | 140.411°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitropropiophenone |