Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,1,1-Trifluoro-N-Nitromethanesulfonamide |
|---|---|
| Synonyms | 1,1,1-trifluoro-N-nitromethanesulfonamide |
| Molecular Structure |  |
| Molecular Formula | CHF3N2O4S |
| Molecular Weight | 194.09 |
| CAS Registry Number | 174191-66-3 |
| SMILES | C(F)(F)(F)S(=O)(=O)N[N+](=O)[O-] |
| InChI | 1S/CHF3N2O4S/c2-1(3,4)11(9,10)5-6(7)8/h5H |
| InChIKey | KSFMNRPVMRDLIJ-UHFFFAOYSA-N |
| Density | 1.865g/cm3 (Cal.) |
|---|---|
| Boiling point | 200.328°C at 760 mmHg (Cal.) |
| Flash point | 74.956°C (Cal.) |
| Refractive index | 1.406 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trifluoro-N-Nitromethanesulfonamide |