Online Database of Chemicals from Around the World
| Name | 4-Hydroxy-3,3,5,5-Tetramethylcyclohexanone |
|---|---|
| Synonyms | 4-Hydroxy-3,3,5,5-tetramethylcyclohexanone # |
| Molecular Structure |  |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 17429-06-0 |
| SMILES | O=C1CC(C)(C)C(O)C(C)(C)C1 |
| InChI | 1S/C10H18O2/c1-9(2)5-7(11)6-10(3,4)8(9)12/h8,12H,5-6H2,1-4H3 |
| InChIKey | SFWIZRXAIOWSGY-UHFFFAOYSA-N |
| Density | 0.963g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.939°C at 760 mmHg (Cal.) |
| Flash point | 100.04°C (Cal.) |
| Refractive index | 1.456 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxy-3,3,5,5-Tetramethylcyclohexanone |
