Online Database of Chemicals from Around the World
| Name | 4-(Isopropylsulfonyl)-2-Thiophenecarbonyl Chloride |
|---|---|
| Synonyms | 4-(Isopropylsulphonyl)thiophene-2-carbonylchloride |
| Molecular Structure |  |
| Molecular Formula | C8H9ClO3S2 |
| Molecular Weight | 252.74 |
| CAS Registry Number | 175202-47-8 |
| SMILES | CC(C)S(=O)(=O)C1=CSC(=C1)C(=O)Cl |
| InChI | 1S/C8H9ClO3S2/c1-5(2)14(11,12)6-3-7(8(9)10)13-4-6/h3-5H,1-2H3 |
| InChIKey | OMDAXENWBHEPIX-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 206.4±28.7°C (Cal.) |
| Refractive index | 1.546 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Isopropylsulfonyl)-2-Thiophenecarbonyl Chloride |
