Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Phenyl N,N'-Dimethylphosphorodiamidate |
|---|---|
| Synonyms | Methyl-(Methylamino-(Phenoxy)Phosphoryl)Amine; 3-06-00-00662 (Beilstein Handbook Reference); Ai3-27222 |
| Molecular Structure |  |
| Molecular Formula | C8H13N2O2P |
| Molecular Weight | 200.18 |
| CAS Registry Number | 1754-58-1 |
| EINECS | 217-144-7 |
| SMILES | C1=CC=CC=C1O[P](NC)(=O)NC |
| InChI | 1S/C8H13N2O2P/c1-9-13(11,10-2)12-8-6-4-3-5-7-8/h3-7H,1-2H3,(H2,9,10,11) |
| InChIKey | ZKIBFASDNPOJFP-UHFFFAOYSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.834°C at 760 mmHg (Cal.) |
| Flash point | 119.411°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl N,N'-Dimethylphosphorodiamidate |