|
CAS#: 17550-03-7 Product: 3-Methoxy-19-Nor-17-alpha-Pregna-1,3,5(10)-Trien-17-beta-Ol No suppilers available for the product. |
| Name | 3-Methoxy-19-Nor-17-alpha-Pregna-1,3,5(10)-Trien-17-beta-Ol |
|---|---|
| Synonyms | 17Alpha-Ethyl-17Beta-Estradiol 3-Methyl Ether; 3-Methoxy-19-Nor-17Alpha-Pregna-1,3,5(10)-Trien-17Beta-Ol; C14661 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 17550-03-7 |
| EINECS | 241-535-1 |
| SMILES | [C@H]34[C@H]2[C@@H](C1=C(C=C(OC)C=C1)CC2)CC[C@@]3([C@@](CC)(O)CC4)C |
| InChI | 1S/C21H30O2/c1-4-21(22)12-10-19-18-7-5-14-13-15(23-3)6-8-16(14)17(18)9-11-20(19,21)2/h6,8,13,17-19,22H,4-5,7,9-12H2,1-3H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | NVYBDSYHTNOJSQ-MJCUULBUSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.152°C at 760 mmHg (Cal.) |
| Flash point | 188.588°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-19-Nor-17-alpha-Pregna-1,3,5(10)-Trien-17-beta-Ol |