Online Database of Chemicals from Around the World
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 (431) 5606-600 | |||
 |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3-Acetoxy-N,N-Dimethylaniline |
|---|---|
| Synonyms | Acetic Acid (3-Dimethylaminophenyl) Ester; (3-Dimethylaminophenyl) Ethanoate; Nsc141193 |
| Molecular Structure |  |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 |
| CAS Registry Number | 17579-36-1 |
| SMILES | C1=C(OC(=O)C)C=CC=C1N(C)C |
| InChI | 1S/C10H13NO2/c1-8(12)13-10-6-4-5-9(7-10)11(2)3/h4-7H,1-3H3 |
| InChIKey | PDKHRSDHGQFHEY-UHFFFAOYSA-N |
| Density | 1.086g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.939°C at 760 mmHg (Cal.) |
| Flash point | 112.352°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Acetoxy-N,N-Dimethylaniline |