Online Database of Chemicals from Around the World
|
CAS#: 1758-64-1 Product: 1,6-Diaminoanthraquinone No suppilers available for the product. |
| Name | 1,6-Diaminoanthraquinone |
|---|---|
| Synonyms | 1,6-Diamino-9,10-Anthraquinone; Nsc39885; Nsc 39885 |
| Molecular Structure |  |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 |
| CAS Registry Number | 1758-64-1 |
| SMILES | C1=C(N)C2=C(C=C1)C(=O)C3=C(C2=O)C=CC(=C3)N |
| InChI | 1S/C14H10N2O2/c15-7-4-5-8-10(6-7)13(17)9-2-1-3-11(16)12(9)14(8)18/h1-6H,15-16H2 |
| InChIKey | UDBLWRCGYSQDGK-UHFFFAOYSA-N |
| Density | 1.456g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.878°C at 760 mmHg (Cal.) |
| Flash point | 287.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Diaminoanthraquinone |