Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Ethan-D5-Amine |
|---|---|
| Synonyms | 1,1,2,2,2-Pentadeuterioethylamine; Ethan-D5-Amine |
| Molecular Structure |  |
| Molecular Formula | C2H2D5N |
| Molecular Weight | 50.12 |
| CAS Registry Number | 17616-24-9 |
| SMILES | C(C([2H])([2H])[2H])(N)([2H])[2H] |
| InChI | 1S/C2H7N/c1-2-3/h2-3H2,1H3/i1D3,2D2 |
| InChIKey | QUSNBJAOOMFDIB-ZBJDZAJPSA-N |
| Density | 0.768g/cm3 (Cal.) |
|---|---|
| Boiling point | 14.229°C at 760 mmHg (Cal.) |
| Flash point | -17.222°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethan-D5-Amine |