Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,3-Epoxy-1,2,3,4-tetrahydroanthracene |
|---|---|
| Synonyms | Zinc03107577 |
| Molecular Structure |  |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 |
| CAS Registry Number | 176236-88-7 |
| SMILES | [C@H]14O[C@H]1CC3=CC2=CC=CC=C2C=C3C4 |
| InChI | 1S/C14H12O/c1-2-4-10-6-12-8-14-13(15-14)7-11(12)5-9(10)3-1/h1-6,13-14H,7-8H2/t13-,14+ |
| InChIKey | VYFQNEPGUNYZJV-OKILXGFUSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.364°C at 760 mmHg (Cal.) |
| Flash point | 167.596°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,3-Epoxy-1,2,3,4-tetrahydroanthracene |