Online Database of Chemicals from Around the World
|
CAS#: 17641-00-8 Product: N-(3,5-Dichlorophenyl)-2,2-Dichloroacetamide No suppilers available for the product. |
| Name | N-(3,5-Dichlorophenyl)-2,2-Dichloroacetamide |
|---|---|
| Synonyms | 2,2-Dichloro-N-(3,5-Dichlorophenyl)Ethanamide; Acetamide, 2,2-Dichloro-N-(3,5-Dichlorophenyl)-; Acetanilide, 2,2,3',5'-Tetrachloro- |
| Molecular Structure |  |
| Molecular Formula | C8H5Cl4NO |
| Molecular Weight | 272.95 |
| CAS Registry Number | 17641-00-8 |
| SMILES | C1=C(NC(C(Cl)Cl)=O)C=C(Cl)C=C1Cl |
| InChI | 1S/C8H5Cl4NO/c9-4-1-5(10)3-6(2-4)13-8(14)7(11)12/h1-3,7H,(H,13,14) |
| InChIKey | SSDPYDABCUKLMX-UHFFFAOYSA-N |
| Density | 1.61g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.873°C at 760 mmHg (Cal.) |
| Flash point | 189.589°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(3,5-Dichlorophenyl)-2,2-Dichloroacetamide |