Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (845) 299-6009/ | |||
|
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 2-Isopropyl-3-Oxo-4-Phenylbutanoate |
|---|---|
| Synonyms | BENZENEBUTANOIC ACID, A-(1-METHYLETHYL)-B-OXO-, ETHYL ESTER; ETHYL 2-ISOPROPYL-3-OXO-4-PHENYLBUTANOATE; ethyl 3-oxo-4-phenyl-2-(propan-2-yl)butanoate |
| Molecular Structure |  |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 |
| CAS Registry Number | 176519-53-2 |
| SMILES | O=C(Cc1ccccc1)C(C(=O)OCC)C(C)C |
| InChI | 1S/C15H20O3/c1-4-18-15(17)14(11(2)3)13(16)10-12-8-6-5-7-9-12/h5-9,11,14H,4,10H2,1-3H3 |
| InChIKey | GLMIDTBEENEUNW-UHFFFAOYSA-N |
| Density | 1.038g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.193°C at 760 mmHg (Cal.) |
| Flash point | 140.198°C (Cal.) |
| Refractive index | 1.497 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-Isopropyl-3-Oxo-4-Phenylbutanoate |