| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Progesterone EP Impurity K |
|---|---|
| Synonyms | 17-Acetyl-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 |
| CAS Registry Number | 17652-16-3 |
| SMILES | CC(=O)C1CCC2C1(CC=C3C2CCC4=CC(=O)CCC43C)C |
| Solubility | 9.073 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.557, Calc.* |
| Melting point | 155.10 °C |
| Boiling Point | 400.08 °C, 460.8±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 171.4±25.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302+H312+H332-H315-H319 Details |
| Safety Statements | P261-P271-P280-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Progesterone EP Impurity K |