| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.fine-chemtech.com | |||
![]() | +86 (25) 5207-8417 +86 17714198479 | |||
![]() | +86 (25) 5207-8417 | |||
![]() | sales@fine-chemtech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink Standard supplier since 2007 | ||||
| Name | Bisoxatin |
|---|---|
| Synonyms | 2,2-bis(4-hydroxyphenyl)-4H-1,4-benzoxazin-3-one |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 |
| CAS Registry Number | 17692-24-9 |
| EC Number | 241-681-6 |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(O2)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
| Solubility | 36.41 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.675, Calc.* |
| Melting point | 242.27 °C |
| Boiling Point | 563.52 °C, 609.0±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 322.1±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Bisoxatin |