Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,10-Dihydrophenazine |
|---|---|
| Synonyms | 2,10-dihydrophenazine |
| Molecular Structure |  |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 177028-12-5 |
| SMILES | c1ccc2c(c1)NC3=CCC=CC3=N2 |
| InChI | 1S/C12H10N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-3,5-8,14H,4H2 |
| InChIKey | GMOGVMIKHQEKMP-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.76°C at 760 mmHg (Cal.) |
| Flash point | 163.515°C (Cal.) |
| Refractive index | 1.676 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,10-Dihydrophenazine |