Online Database of Chemicals from Around the World
| Name | Fluoro(Methyl)Diphenylsilane |
|---|---|
| Synonyms | Diphenylmethylfluorosilane; Fluoromethyldiphenylsilane |
| Molecular Structure |  |
| Molecular Formula | C13H13FSi |
| Molecular Weight | 216.33 |
| CAS Registry Number | 17739-53-6 |
| SMILES | F[Si](c1ccccc1)(c2ccccc2)C |
| InChI | 1S/C13H13FSi/c1-15(14,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | IKJRVUCIKVZRRR-UHFFFAOYSA-N |
| Density | 1.041g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.1935°C (Expl.) |
| 258.173°C at 760 mmHg (Cal.) | |
| Flash point | 109.94°C (Cal.) |
| Refractive index | 1.538 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Fluoro(Methyl)Diphenylsilane |
