Online Database of Chemicals from Around the World
|
CAS#: 17790-61-3 Product: 4-Chloro-4'-Isopropylbiphenyl No suppilers available for the product. |
| Name | 4-Chloro-4'-Isopropylbiphenyl |
|---|---|
| Synonyms | 1-(4-Chlorophenyl)-4-Isopropyl-Benzene; 1-(4-Chlorophenyl)-4-Isopropylbenzene; 1-(4-Chlorophenyl)-4-Propan-2-Yl-Benzene |
| Molecular Structure |  |
| Molecular Formula | C15H15Cl |
| Molecular Weight | 230.74 |
| CAS Registry Number | 17790-61-3 |
| SMILES | C1=CC(=CC=C1Cl)C2=CC=C(C=C2)C(C)C |
| InChI | 1S/C15H15Cl/c1-11(2)12-3-5-13(6-4-12)14-7-9-15(16)10-8-14/h3-11H,1-2H3 |
| InChIKey | GCOSAGZKCBKMJV-UHFFFAOYSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.206°C at 760 mmHg (Cal.) |
| Flash point | 135.095°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-4'-Isopropylbiphenyl |