Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Isopropyl 3,5-Diamino-4-Hydroxy-Benzoate |
|---|---|
| Synonyms | isopropyl 3,5-diamino-4-hydroxybenzoate |
| Molecular Structure |  |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 177960-60-0 |
| SMILES | Nc1cc(cc(N)c1O)C(=O)OC(C)C |
| InChI | 1S/C10H14N2O3/c1-5(2)15-10(14)6-3-7(11)9(13)8(12)4-6/h3-5,13H,11-12H2,1-2H3 |
| InChIKey | FTFWCSRUIUXUDY-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.057°C at 760 mmHg (Cal.) |
| Flash point | 192.119°C (Cal.) |
| Refractive index | 1.621 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl 3,5-Diamino-4-Hydroxy-Benzoate |